C22H19NO6S2 — CID 71712705
[(E)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]benzene (PubChem CID 71712705) has the molecular formula C22H19NO6S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is [(E)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]benzene.
| Compound Name | [(E)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]benzene |
|---|---|
| PubChem CID | 71712705 |
| Molecular Formula | C22H19NO6S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | [(E)-4,4-bis(benzenesulfonyl)-2-nitrobut-1-enyl]benzene |
| SMILES | O=[N+]([O-])/C(=C/c1ccccc1)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19NO6S2/c24-23(25)19(16-18-10-4-1-5-11-18)17-22(30(26,27)20-12-6-2-7-13-20)31(28,29)21-14-8-3-9-15-21/h1-16,22H,17H2/b19-16+ |
| InChIKey | KLMCFYVQHREHAL-KNTRCKAVSA-N |
| XLogP | 3.97 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|