C13H17NO5S — CID 15727077
(E,2S,5R)-6-(benzenesulfonyl)-5-methyl-6-nitrohex-3-en-2-ol (PubChem CID 15727077) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is (E,2S,5R)-6-(benzenesulfonyl)-5-methyl-6-nitrohex-3-en-2-ol.
| Compound Name | (E,2S,5R)-6-(benzenesulfonyl)-5-methyl-6-nitrohex-3-en-2-ol |
|---|---|
| PubChem CID | 15727077 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (E,2S,5R)-6-(benzenesulfonyl)-5-methyl-6-nitrohex-3-en-2-ol |
| SMILES | C[C@H](O)/C=C/[C@@H](C)C([N+](=O)[O-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO5S/c1-10(8-9-11(2)15)13(14(16)17)20(18,19)12-6-4-3-5-7-12/h3-11,13,15H,1-2H3/b9-8+/t10-,11+,13?/m1/s1 |
| InChIKey | BOVOVROGWBXEJI-PZKMBJDNSA-N |
| XLogP | 1.64 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|