C13H20O3S — CID 100987335
(2R,3S)-3-(benzenesulfonyl)-5-methylhexan-2-ol (PubChem CID 100987335) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is (2R,3S)-3-(benzenesulfonyl)-5-methylhexan-2-ol.
| Compound Name | (2R,3S)-3-(benzenesulfonyl)-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 100987335 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2R,3S)-3-(benzenesulfonyl)-5-methylhexan-2-ol |
| SMILES | CC(C)C[C@@H]([C@@H](C)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H20O3S/c1-10(2)9-13(11(3)14)17(15,16)12-7-5-4-6-8-12/h4-8,10-11,13-14H,9H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | WGSCFGNCAMCPPJ-YPMHNXCESA-N |
| XLogP | 2.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |