C23H23NO7S2 — CID 101463215
1-[(2R)-4,4-bis(benzenesulfonyl)-2-nitrobutyl]-4-methoxybenzene (PubChem CID 101463215) has the molecular formula C23H23NO7S2 and a molecular weight of 489.57 g/mol. Its IUPAC name is 1-[(2R)-4,4-bis(benzenesulfonyl)-2-nitrobutyl]-4-methoxybenzene.
| Compound Name | 1-[(2R)-4,4-bis(benzenesulfonyl)-2-nitrobutyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 101463215 |
| Molecular Formula | C23H23NO7S2 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 1-[(2R)-4,4-bis(benzenesulfonyl)-2-nitrobutyl]-4-methoxybenzene |
| SMILES | COc1ccc(C[C@H](CC(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H23NO7S2/c1-31-20-14-12-18(13-15-20)16-19(24(25)26)17-23(32(27,28)21-8-4-2-5-9-21)33(29,30)22-10-6-3-7-11-22/h2-15,19,23H,16-17H2,1H3/t19-/m1/s1 |
| InChIKey | MJQNXEONQOPJHD-LJQANCHMSA-N |
| XLogP | 3.55 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|