C12H19NO5S — CID 161451981
ethyl (2S)-2-amino-3-hydroxypropanoate;methylsulfonylbenzene (PubChem CID 161451981) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is ethyl (2S)-2-amino-3-hydroxypropanoate;methylsulfonylbenzene.
| Compound Name | ethyl (2S)-2-amino-3-hydroxypropanoate;methylsulfonylbenzene |
|---|---|
| PubChem CID | 161451981 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | ethyl (2S)-2-amino-3-hydroxypropanoate;methylsulfonylbenzene |
| SMILES | CCOC(=O)[C@@H](N)CO.CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8O2S.C5H11NO3/c1-10(8,9)7-5-3-2-4-6-7;1-2-9-5(8)4(6)3-7/h2-6H,1H3;4,7H,2-3,6H2,1H3/t;4-/m.0/s1 |
| InChIKey | WAQKWTKBBXMNMA-VWMHFEHESA-N |
| XLogP | -0.04 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |