C21H22O6S2 — CID 134900635
methyl (1R,5R)-5-[bis(benzenesulfonyl)methyl]cyclohex-3-ene-1-carboxylate (PubChem CID 134900635) has the molecular formula C21H22O6S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is methyl (1R,5R)-5-[bis(benzenesulfonyl)methyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,5R)-5-[bis(benzenesulfonyl)methyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134900635 |
| Molecular Formula | C21H22O6S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | methyl (1R,5R)-5-[bis(benzenesulfonyl)methyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=C[C@H](C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H22O6S2/c1-27-20(22)16-9-8-10-17(15-16)21(28(23,24)18-11-4-2-5-12-18)29(25,26)19-13-6-3-7-14-19/h2-8,10-14,16-17,21H,9,15H2,1H3/t16-,17+/m1/s1 |
| InChIKey | FZXVUIAPBSUUNQ-SJORKVTESA-N |
| XLogP | 3.02 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|