C24H26O8S2 — CID 10006395
dimethyl 2-[2,3-bis(benzenesulfonyl)but-3-enyl]-2-prop-2-enylpropanedioate (PubChem CID 10006395) has the molecular formula C24H26O8S2 and a molecular weight of 506.60 g/mol. Its IUPAC name is dimethyl 2-[2,3-bis(benzenesulfonyl)but-3-enyl]-2-prop-2-enylpropanedioate.
| Compound Name | dimethyl 2-[2,3-bis(benzenesulfonyl)but-3-enyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 10006395 |
| Molecular Formula | C24H26O8S2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | dimethyl 2-[2,3-bis(benzenesulfonyl)but-3-enyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(CC(C(=C)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H26O8S2/c1-5-16-24(22(25)31-3,23(26)32-4)17-21(34(29,30)20-14-10-7-11-15-20)18(2)33(27,28)19-12-8-6-9-13-19/h5-15,21H,1-2,16-17H2,3-4H3 |
| InChIKey | AKWKVURDNUTKNL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|