C25H22F6O8S2 — CID 135061503
bis(2,2,2-trifluoroethyl) (4S)-3,3-bis(benzenesulfonyl)-4-ethenylcyclopentane-1,1-dicarboxylate (PubChem CID 135061503) has the molecular formula C25H22F6O8S2 and a molecular weight of 628.57 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) (4S)-3,3-bis(benzenesulfonyl)-4-ethenylcyclopentane-1,1-dicarboxylate.
| Compound Name | bis(2,2,2-trifluoroethyl) (4S)-3,3-bis(benzenesulfonyl)-4-ethenylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135061503 |
| Molecular Formula | C25H22F6O8S2 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) (4S)-3,3-bis(benzenesulfonyl)-4-ethenylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OCC(F)(F)F)(C(=O)OCC(F)(F)F)CC1(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22F6O8S2/c1-2-17-13-22(20(32)38-15-24(26,27)28,21(33)39-16-25(29,30)31)14-23(17,40(34,35)18-9-5-3-6-10-18)41(36,37)19-11-7-4-8-12-19/h2-12,17H,1,13-16H2/t17-/m1/s1 |
| InChIKey | SUMWFDBPJNAVCS-QGZVFWFLSA-N |
| XLogP | 4.42 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|