C23H26O6S2 — CID 10479476
cis-dimethyl (3R,4S)-3-(benzenesulfonylmethyl)-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 10479476) has the molecular formula C23H26O6S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is cis-dimethyl (3R,4S)-3-(benzenesulfonylmethyl)-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3R,4S)-3-(benzenesulfonylmethyl)-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10479476 |
| Molecular Formula | C23H26O6S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | cis-dimethyl (3R,4S)-3-(benzenesulfonylmethyl)-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](CSc2ccccc2)[C@H](CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C23H26O6S2/c1-28-21(24)23(22(25)29-2)13-17(15-30-19-9-5-3-6-10-19)18(14-23)16-31(26,27)20-11-7-4-8-12-20/h3-12,17-18H,13-16H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | CNRXOXSCPKZAFP-MSOLQXFVSA-N |
| XLogP | 3.61 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|