C22H24O4S2 — CID 102072637
dimethyl (3S)-3-phenylsulfanyl-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 102072637) has the molecular formula C22H24O4S2 and a molecular weight of 416.56 g/mol. Its IUPAC name is dimethyl (3S)-3-phenylsulfanyl-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3S)-3-phenylsulfanyl-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102072637 |
| Molecular Formula | C22H24O4S2 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | dimethyl (3S)-3-phenylsulfanyl-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(CSc2ccccc2)[C@@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C22H24O4S2/c1-25-20(23)22(21(24)26-2)13-16(15-27-17-9-5-3-6-10-17)19(14-22)28-18-11-7-4-8-12-18/h3-12,16,19H,13-15H2,1-2H3/t16?,19-/m0/s1 |
| InChIKey | CRVMOZHVKARLRN-CVMIBEPCSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|