C25H28O4S2 — CID 134899698
diethyl 2-[(Z)-2,3-bis(phenylsulfanyl)prop-2-enyl]-2-prop-2-enylpropanedioate (PubChem CID 134899698) has the molecular formula C25H28O4S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is diethyl 2-[(Z)-2,3-bis(phenylsulfanyl)prop-2-enyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[(Z)-2,3-bis(phenylsulfanyl)prop-2-enyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 134899698 |
| Molecular Formula | C25H28O4S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | diethyl 2-[(Z)-2,3-bis(phenylsulfanyl)prop-2-enyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C/C(=C/Sc1ccccc1)Sc1ccccc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H28O4S2/c1-4-17-25(23(26)28-5-2,24(27)29-6-3)18-22(31-21-15-11-8-12-16-21)19-30-20-13-9-7-10-14-20/h4,7-16,19H,1,5-6,17-18H2,2-3H3/b22-19- |
| InChIKey | MVCFNVFNIKENJS-QOCHGBHMSA-N |
| XLogP | 6.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|