C19H20O4S2 — CID 12815306
diethyl 2,2-bis(phenylsulfanyl)propanedioate (PubChem CID 12815306) has the molecular formula C19H20O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is diethyl 2,2-bis(phenylsulfanyl)propanedioate.
| Compound Name | diethyl 2,2-bis(phenylsulfanyl)propanedioate |
|---|---|
| PubChem CID | 12815306 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | diethyl 2,2-bis(phenylsulfanyl)propanedioate |
| SMILES | CCOC(=O)C(Sc1ccccc1)(Sc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C19H20O4S2/c1-3-22-17(20)19(18(21)23-4-2,24-15-11-7-5-8-12-15)25-16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | AXBZDCDGRDUTQJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|