About prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate
prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate (PubChem CID 71466861) has the molecular formula C19H16O3S
and a molecular weight of 324.40 g/mol. Its IUPAC name is prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate |
| PubChem CID | 71466861 |
| Molecular Formula | C19H16O3S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate |
| SMILES | C#CCOC(=O)C(C(C)=O)=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16O3S/c1-3-14-22-19(21)18(15(2)20)23(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h1,4-13H,14H2,2H3 |
| InChIKey | BIMYKOREUXUDRR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate?
The IUPAC name of prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate (CID 71466861) is prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate.
What is the SMILES notation for prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate?
The canonical SMILES for prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate is C#CCOC(=O)C(C(C)=O)=S(c1ccccc1)c1ccccc1.
What is the InChIKey of prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate?
The InChIKey is BIMYKOREUXUDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O3S/c1-3-14-22-19(21)18(15(2)20)23(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h1,4-13H,14H2,2H3.
What are the key properties of prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate?
prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate has a molecular weight of 324.40 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate is sourced from PubChem (CID 71466861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).