C18H16F3O3S+ — CID 164668415
[2,4-dioxo-4-(2,2,2-trifluoroethoxy)butyl]-diphenylsulfanium (PubChem CID 164668415) has the molecular formula C18H16F3O3S+ and a molecular weight of 369.38 g/mol. Its IUPAC name is [2,4-dioxo-4-(2,2,2-trifluoroethoxy)butyl]-diphenylsulfanium.
| Compound Name | [2,4-dioxo-4-(2,2,2-trifluoroethoxy)butyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 164668415 |
| Molecular Formula | C18H16F3O3S+ |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [2,4-dioxo-4-(2,2,2-trifluoroethoxy)butyl]-diphenylsulfanium |
| SMILES | O=C(CC(=O)OCC(F)(F)F)C[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16F3O3S/c19-18(20,21)13-24-17(23)11-14(22)12-25(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10H,11-13H2/q+1 |
| InChIKey | KPNVUWIXMJUJFH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|