C13H13F3O3S — CID 135058875
ethyl (2Z)-4,4,4-trifluoro-2-[methyl(phenyl)-λ4-sulfanylidene]-3-oxobutanoate (PubChem CID 135058875) has the molecular formula C13H13F3O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is ethyl (2Z)-4,4,4-trifluoro-2-[methyl(phenyl)-λ4-sulfanylidene]-3-oxobutanoate.
| Compound Name | ethyl (2Z)-4,4,4-trifluoro-2-[methyl(phenyl)-λ4-sulfanylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 135058875 |
| Molecular Formula | C13H13F3O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | ethyl (2Z)-4,4,4-trifluoro-2-[methyl(phenyl)-λ4-sulfanylidene]-3-oxobutanoate |
| SMILES | CCOC(=O)/C(C(=O)C(F)(F)F)=S(/C)c1ccccc1 |
| InChI | InChI=1S/C13H13F3O3S/c1-3-19-12(18)10(11(17)13(14,15)16)20(2)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3 |
| InChIKey | CMESZCVDADUPPJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|