C15H15F3O3S — CID 135057674
ethyl 2-phenylsulfanyl-2-(2,2,2-trifluoroacetyl)pent-4-enoate (PubChem CID 135057674) has the molecular formula C15H15F3O3S and a molecular weight of 332.34 g/mol. Its IUPAC name is ethyl 2-phenylsulfanyl-2-(2,2,2-trifluoroacetyl)pent-4-enoate.
| Compound Name | ethyl 2-phenylsulfanyl-2-(2,2,2-trifluoroacetyl)pent-4-enoate |
|---|---|
| PubChem CID | 135057674 |
| Molecular Formula | C15H15F3O3S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | ethyl 2-phenylsulfanyl-2-(2,2,2-trifluoroacetyl)pent-4-enoate |
| SMILES | C=CCC(Sc1ccccc1)(C(=O)OCC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H15F3O3S/c1-3-10-14(13(20)21-4-2,12(19)15(16,17)18)22-11-8-6-5-7-9-11/h3,5-9H,1,4,10H2,2H3 |
| InChIKey | RHWTUWBCUMCUAX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|