C19H24O6S — CID 11014394
dimethyl 3-ethenyl-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate (PubChem CID 11014394) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is dimethyl 3-ethenyl-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-ethenyl-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11014394 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | dimethyl 3-ethenyl-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OC)(C(=O)OC)CC1CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H24O6S/c1-5-14-10-19(17(20)24-3,18(21)25-4)11-15(14)12-26(22,23)16-8-6-13(2)7-9-16/h5-9,14-15H,1,10-12H2,2-4H3 |
| InChIKey | MAVOELKQRNIQCZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|