C30H29NaO10S3 — CID 10652041
sodium dimethyl 2-[2-(benzenesulfonyl)prop-2-enyl]-2-[2,3-bis(benzenesulfonyl)but-3-enyl]propanedioate (PubChem CID 10652041) has the molecular formula C30H29NaO10S3 and a molecular weight of 668.74 g/mol. Its IUPAC name is sodium dimethyl 2-[2-(benzenesulfonyl)prop-2-enyl]-2-[2,3-bis(benzenesulfonyl)but-3-enyl]propanedioate.
| Compound Name | sodium dimethyl 2-[2-(benzenesulfonyl)prop-2-enyl]-2-[2,3-bis(benzenesulfonyl)but-3-enyl]propanedioate |
|---|---|
| PubChem CID | 10652041 |
| Molecular Formula | C30H29NaO10S3 |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 668.08 |
| IUPAC Name | sodium dimethyl 2-[2-(benzenesulfonyl)prop-2-enyl]-2-[2,3-bis(benzenesulfonyl)but-3-enyl]propanedioate |
| SMILES | C=C(CC(C[C-](C(=C)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C30H29O10S3.Na/c1-22(41(33,34)24-14-8-5-9-15-24)20-30(28(31)39-3,29(32)40-4)21-27(43(37,38)26-18-12-7-13-19-26)23(2)42(35,36)25-16-10-6-11-17-25;/h5-19H,1-2,20-21H2,3-4H3;/q-1;+1 |
| InChIKey | KBVYZTQTIKPUCL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 155.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|