C29H28O6S2 — CID 135061628
dimethyl (3R)-2,2-bis[(S)-(4-methylphenyl)sulfinyl]-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate (PubChem CID 135061628) has the molecular formula C29H28O6S2 and a molecular weight of 536.67 g/mol. Its IUPAC name is dimethyl (3R)-2,2-bis[(S)-(4-methylphenyl)sulfinyl]-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl (3R)-2,2-bis[(S)-(4-methylphenyl)sulfinyl]-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135061628 |
| Molecular Formula | C29H28O6S2 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | dimethyl (3R)-2,2-bis[(S)-(4-methylphenyl)sulfinyl]-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](/C=C/c2ccccc2)C1([S@@](=O)c1ccc(C)cc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H28O6S2/c1-20-10-15-23(16-11-20)36(32)29(37(33)24-17-12-21(2)13-18-24)25(19-14-22-8-6-5-7-9-22)28(29,26(30)34-3)27(31)35-4/h5-19,25H,1-4H3/b19-14+/t25-,36+,37+/m1/s1 |
| InChIKey | PXKGDRQOLQCSJV-XMRVRZHZSA-N |
| XLogP | 4.59 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|