C24H30O6S2 — CID 135062726
dimethyl 2-[(2R)-3-methyl-1,1-bis[(S)-(4-methylphenyl)sulfinyl]butan-2-yl]propanedioate (PubChem CID 135062726) has the molecular formula C24H30O6S2 and a molecular weight of 478.63 g/mol. Its IUPAC name is dimethyl 2-[(2R)-3-methyl-1,1-bis[(S)-(4-methylphenyl)sulfinyl]butan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R)-3-methyl-1,1-bis[(S)-(4-methylphenyl)sulfinyl]butan-2-yl]propanedioate |
|---|---|
| PubChem CID | 135062726 |
| Molecular Formula | C24H30O6S2 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | dimethyl 2-[(2R)-3-methyl-1,1-bis[(S)-(4-methylphenyl)sulfinyl]butan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](C(C)C)C([S@@](=O)c1ccc(C)cc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H30O6S2/c1-15(2)20(21(22(25)29-5)23(26)30-6)24(31(27)18-11-7-16(3)8-12-18)32(28)19-13-9-17(4)10-14-19/h7-15,20-21,24H,1-6H3/t20-,31+,32+/m1/s1 |
| InChIKey | PSCBKDDBDOKSCH-XDHIMOHDSA-N |
| XLogP | 3.78 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|