C17H20O6S — CID 10338081
dimethyl (2S)-2-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]cyclopropane-1,1-dicarboxylate (PubChem CID 10338081) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is dimethyl (2S)-2-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl (2S)-2-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10338081 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | dimethyl (2S)-2-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]cyclopropane-1,1-dicarboxylate |
| SMILES | C/C=C/[C@@]1(S(=O)(=O)c2ccc(C)cc2)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H20O6S/c1-5-10-16(11-17(16,14(18)22-3)15(19)23-4)24(20,21)13-8-6-12(2)7-9-13/h5-10H,11H2,1-4H3/b10-5+/t16-/m1/s1 |
| InChIKey | SDKMXTVOKRPGKK-ZWIJEDICSA-N |
| XLogP | 1.82 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|