C24H28O6S2 — CID 5252416
dimethyl 2,2-bis[(4-methylphenyl)sulfinyl]-3-propan-2-ylcyclopropane-1,1-dicarboxylate (PubChem CID 5252416) has the molecular formula C24H28O6S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is dimethyl 2,2-bis[(4-methylphenyl)sulfinyl]-3-propan-2-ylcyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2,2-bis[(4-methylphenyl)sulfinyl]-3-propan-2-ylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 5252416 |
| Molecular Formula | C24H28O6S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | dimethyl 2,2-bis[(4-methylphenyl)sulfinyl]-3-propan-2-ylcyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(C(C)C)C1(S(=O)c1ccc(C)cc1)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28O6S2/c1-15(2)20-23(21(25)29-5,22(26)30-6)24(20,31(27)18-11-7-16(3)8-12-18)32(28)19-13-9-17(4)10-14-19/h7-15,20H,1-6H3 |
| InChIKey | LIBYIISDJMXLFZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|