C20H24O5S — CID 102062767
diethyl (6R)-6-methyl-2-(4-methylphenyl)sulfinylcyclohexa-2,4-diene-1,1-dicarboxylate (PubChem CID 102062767) has the molecular formula C20H24O5S and a molecular weight of 376.47 g/mol. Its IUPAC name is diethyl (6R)-6-methyl-2-(4-methylphenyl)sulfinylcyclohexa-2,4-diene-1,1-dicarboxylate.
| Compound Name | diethyl (6R)-6-methyl-2-(4-methylphenyl)sulfinylcyclohexa-2,4-diene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102062767 |
| Molecular Formula | C20H24O5S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | diethyl (6R)-6-methyl-2-(4-methylphenyl)sulfinylcyclohexa-2,4-diene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(S(=O)c2ccc(C)cc2)=CC=C[C@H]1C |
| InChI | InChI=1S/C20H24O5S/c1-5-24-18(21)20(19(22)25-6-2)15(4)8-7-9-17(20)26(23)16-12-10-14(3)11-13-16/h7-13,15H,5-6H2,1-4H3/t15-,26?/m1/s1 |
| InChIKey | SKDASOVMMVQQAI-GJNAARLKSA-N |
| XLogP | 3.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|