C31H32O10S3 — CID 10652162
dimethyl 2-[(E)-4-(benzenesulfonyl)but-3-enyl]-2-[2,3-bis(benzenesulfonyl)but-3-enyl]propanedioate (PubChem CID 10652162) has the molecular formula C31H32O10S3 and a molecular weight of 660.79 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-(benzenesulfonyl)but-3-enyl]-2-[2,3-bis(benzenesulfonyl)but-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E)-4-(benzenesulfonyl)but-3-enyl]-2-[2,3-bis(benzenesulfonyl)but-3-enyl]propanedioate |
|---|---|
| PubChem CID | 10652162 |
| Molecular Formula | C31H32O10S3 |
| Molecular Weight | 660.79 g/mol |
| Exact Mass | 660.12 |
| IUPAC Name | dimethyl 2-[(E)-4-(benzenesulfonyl)but-3-enyl]-2-[2,3-bis(benzenesulfonyl)but-3-enyl]propanedioate |
| SMILES | C=C(C(CC(CC/C=C/S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H32O10S3/c1-24(43(36,37)26-17-9-5-10-18-26)28(44(38,39)27-19-11-6-12-20-27)23-31(29(32)40-2,30(33)41-3)21-13-14-22-42(34,35)25-15-7-4-8-16-25/h4-12,14-20,22,28H,1,13,21,23H2,2-3H3/b22-14+ |
| InChIKey | ZVGBCXKZIIKOAG-HYARGMPZSA-N |
| XLogP | 4.31 |
| TPSA | 155.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|