C20H22O3S — CID 90794207
(4aR,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-1-methylidene-8,9,10,10a-tetrahydro-7H-benzo[8]annulen-2-one (PubChem CID 90794207) has the molecular formula C20H22O3S and a molecular weight of 342.46 g/mol. Its IUPAC name is (4aR,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-1-methylidene-8,9,10,10a-tetrahydro-7H-benzo[8]annulen-2-one.
| Compound Name | (4aR,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-1-methylidene-8,9,10,10a-tetrahydro-7H-benzo[8]annulen-2-one |
|---|---|
| PubChem CID | 90794207 |
| Molecular Formula | C20H22O3S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (4aR,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-1-methylidene-8,9,10,10a-tetrahydro-7H-benzo[8]annulen-2-one |
| SMILES | C=C1C(=O)C=C[C@@]2(C)C=CCCC[C@@H](S(=O)(=O)c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C20H22O3S/c1-15-17(21)12-14-20(2)13-8-4-7-11-18(19(15)20)24(22,23)16-9-5-3-6-10-16/h3,5-6,8-10,12-14,18-19H,1,4,7,11H2,2H3/t18-,19+,20-/m1/s1 |
| InChIKey | IVCKVNQOCWVADF-HSALFYBXSA-N |
| XLogP | 3.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|