C21H24O5S — CID 10548321
methyl (1S,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-2-oxo-1,7,8,9,10,10a-hexahydrobenzo[8]annulene-1-carboxylate (PubChem CID 10548321) has the molecular formula C21H24O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl (1S,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-2-oxo-1,7,8,9,10,10a-hexahydrobenzo[8]annulene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-2-oxo-1,7,8,9,10,10a-hexahydrobenzo[8]annulene-1-carboxylate |
|---|---|
| PubChem CID | 10548321 |
| Molecular Formula | C21H24O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl (1S,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-4a-methyl-2-oxo-1,7,8,9,10,10a-hexahydrobenzo[8]annulene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C=C[C@@]2(C)/C=C\CCC[C@@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C21H24O5S/c1-21-13-8-4-7-11-17(27(24,25)15-9-5-3-6-10-15)19(21)18(20(23)26-2)16(22)12-14-21/h3,5-6,8-10,12-14,17-19H,4,7,11H2,1-2H3/b13-8-/t17-,18-,19+,21-/m1/s1 |
| InChIKey | DFKCALDBPKLMEG-OCIHZDNZSA-N |
| XLogP | 3.12 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|