C21H26O4S — CID 10667143
(1R,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-1-(methoxymethyl)-4a-methyl-1,7,8,9,10,10a-hexahydrobenzo[8]annulen-2-one (PubChem CID 10667143) has the molecular formula C21H26O4S and a molecular weight of 374.50 g/mol. Its IUPAC name is (1R,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-1-(methoxymethyl)-4a-methyl-1,7,8,9,10,10a-hexahydrobenzo[8]annulen-2-one.
| Compound Name | (1R,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-1-(methoxymethyl)-4a-methyl-1,7,8,9,10,10a-hexahydrobenzo[8]annulen-2-one |
|---|---|
| PubChem CID | 10667143 |
| Molecular Formula | C21H26O4S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (1R,4aR,5Z,10R,10aS)-10-(benzenesulfonyl)-1-(methoxymethyl)-4a-methyl-1,7,8,9,10,10a-hexahydrobenzo[8]annulen-2-one |
| SMILES | COC[C@@H]1C(=O)C=C[C@@]2(C)/C=C\CCC[C@@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C21H26O4S/c1-21-13-8-4-7-11-19(26(23,24)16-9-5-3-6-10-16)20(21)17(15-25-2)18(22)12-14-21/h3,5-6,8-10,12-14,17,19-20H,4,7,11,15H2,1-2H3/b13-8-/t17-,19-,20-,21-/m1/s1 |
| InChIKey | APWDEBHNCDDYMA-CRGNPIIWSA-N |
| XLogP | 3.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|