C22H36O2S — CID 134874869
5-methoxy-2,2,4-trimethyl-6-phenylsulfanyldodecan-3-one (PubChem CID 134874869) has the molecular formula C22H36O2S and a molecular weight of 364.60 g/mol. Its IUPAC name is 5-methoxy-2,2,4-trimethyl-6-phenylsulfanyldodecan-3-one.
| Compound Name | 5-methoxy-2,2,4-trimethyl-6-phenylsulfanyldodecan-3-one |
|---|---|
| PubChem CID | 134874869 |
| Molecular Formula | C22H36O2S |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 5-methoxy-2,2,4-trimethyl-6-phenylsulfanyldodecan-3-one |
| SMILES | CCCCCCC(Sc1ccccc1)C(OC)C(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C22H36O2S/c1-7-8-9-13-16-19(25-18-14-11-10-12-15-18)20(24-6)17(2)21(23)22(3,4)5/h10-12,14-15,17,19-20H,7-9,13,16H2,1-6H3 |
| InChIKey | DLVKWRVLHKEFNO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|