C23H36N2O3S — CID 102485720
tert-butyl N-[(3R,4S,5S)-1-cyano-3-methoxy-5-phenylsulfanyldecan-4-yl]carbamate (PubChem CID 102485720) has the molecular formula C23H36N2O3S and a molecular weight of 420.62 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S,5S)-1-cyano-3-methoxy-5-phenylsulfanyldecan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S,5S)-1-cyano-3-methoxy-5-phenylsulfanyldecan-4-yl]carbamate |
|---|---|
| PubChem CID | 102485720 |
| Molecular Formula | C23H36N2O3S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | tert-butyl N-[(3R,4S,5S)-1-cyano-3-methoxy-5-phenylsulfanyldecan-4-yl]carbamate |
| SMILES | CCCCC[C@H](Sc1ccccc1)[C@@H](NC(=O)OC(C)(C)C)[C@@H](CCC#N)OC |
| InChI | InChI=1S/C23H36N2O3S/c1-6-7-9-16-20(29-18-13-10-8-11-14-18)21(19(27-5)15-12-17-24)25-22(26)28-23(2,3)4/h8,10-11,13-14,19-21H,6-7,9,12,15-16H2,1-5H3,(H,25,26)/t19-,20+,21+/m1/s1 |
| InChIKey | NURUELKKUWIKQH-HKBOAZHASA-N |
| XLogP | 5.94 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|