C19H19BrN2O2S — CID 145008037
tert-butyl N-[(2-bromo-4-cyanophenyl)-phenylsulfanylmethyl]carbamate (PubChem CID 145008037) has the molecular formula C19H19BrN2O2S and a molecular weight of 419.34 g/mol. Its IUPAC name is tert-butyl N-[(2-bromo-4-cyanophenyl)-phenylsulfanylmethyl]carbamate.
| Compound Name | tert-butyl N-[(2-bromo-4-cyanophenyl)-phenylsulfanylmethyl]carbamate |
|---|---|
| PubChem CID | 145008037 |
| Molecular Formula | C19H19BrN2O2S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | tert-butyl N-[(2-bromo-4-cyanophenyl)-phenylsulfanylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Sc1ccccc1)c1ccc(C#N)cc1Br |
| InChI | InChI=1S/C19H19BrN2O2S/c1-19(2,3)24-18(23)22-17(25-14-7-5-4-6-8-14)15-10-9-13(12-21)11-16(15)20/h4-11,17H,1-3H3,(H,22,23) |
| InChIKey | NXJJEMVUKFFPBO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|