C20H22N2O3S2 — CID 138630913
tert-butyl N-[(4-cyano-2-methylsulfinylphenyl)-phenylsulfanylmethyl]carbamate (PubChem CID 138630913) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl N-[(4-cyano-2-methylsulfinylphenyl)-phenylsulfanylmethyl]carbamate.
| Compound Name | tert-butyl N-[(4-cyano-2-methylsulfinylphenyl)-phenylsulfanylmethyl]carbamate |
|---|---|
| PubChem CID | 138630913 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | tert-butyl N-[(4-cyano-2-methylsulfinylphenyl)-phenylsulfanylmethyl]carbamate |
| SMILES | CS(=O)c1cc(C#N)ccc1C(NC(=O)OC(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-20(2,3)25-19(23)22-18(26-15-8-6-5-7-9-15)16-11-10-14(13-21)12-17(16)27(4)24/h5-12,18H,1-4H3,(H,22,23) |
| InChIKey | VIQXIGRZSDXBPK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|