C14H19NO3S — CID 58517097
S-phenyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate (PubChem CID 58517097) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is S-phenyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate.
| Compound Name | S-phenyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate |
|---|---|
| PubChem CID | 58517097 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | S-phenyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C14H19NO3S/c1-10(15-13(17)18-14(2,3)4)12(16)19-11-8-6-5-7-9-11/h5-10H,1-4H3,(H,15,17) |
| InChIKey | GISJYYGYOVWEMX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|