C23H30N2O3S — CID 12041288
S-(4-methylphenyl) (2S,3S)-2-(benzylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanethioate (PubChem CID 12041288) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is S-(4-methylphenyl) (2S,3S)-2-(benzylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanethioate.
| Compound Name | S-(4-methylphenyl) (2S,3S)-2-(benzylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanethioate |
|---|---|
| PubChem CID | 12041288 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | S-(4-methylphenyl) (2S,3S)-2-(benzylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanethioate |
| SMILES | Cc1ccc(SC(=O)[C@@H](NCc2ccccc2)[C@H](C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-16-11-13-19(14-12-16)29-21(26)20(24-15-18-9-7-6-8-10-18)17(2)25-22(27)28-23(3,4)5/h6-14,17,20,24H,15H2,1-5H3,(H,25,27)/t17-,20-/m0/s1 |
| InChIKey | YUKYRBZTMVLQDM-PXNSSMCTSA-N |
| XLogP | 4.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|