C39H36N2O3S — CID 101207634
S-(4-methylphenyl) (2S,3S)-2-(benzylamino)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanethioate (PubChem CID 101207634) has the molecular formula C39H36N2O3S and a molecular weight of 612.80 g/mol. Its IUPAC name is S-(4-methylphenyl) (2S,3S)-2-(benzylamino)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanethioate.
| Compound Name | S-(4-methylphenyl) (2S,3S)-2-(benzylamino)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanethioate |
|---|---|
| PubChem CID | 101207634 |
| Molecular Formula | C39H36N2O3S |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | S-(4-methylphenyl) (2S,3S)-2-(benzylamino)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanethioate |
| SMILES | Cc1ccc(SC(=O)[C@@H](NCc2ccccc2)[C@H](Cc2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C39H36N2O3S/c1-27-20-22-30(23-21-27)45-38(42)37(40-25-29-14-6-3-7-15-29)36(24-28-12-4-2-5-13-28)41-39(43)44-26-35-33-18-10-8-16-31(33)32-17-9-11-19-34(32)35/h2-23,35-37,40H,24-26H2,1H3,(H,41,43)/t36-,37-/m0/s1 |
| InChIKey | WBGAJRZQAVFLRD-BCRBLDSWSA-N |
| XLogP | 7.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|