C17H20O3S — CID 133083313
(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexene-1-carbaldehyde (PubChem CID 133083313) has the molecular formula C17H20O3S and a molecular weight of 304.41 g/mol. Its IUPAC name is (4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexene-1-carbaldehyde.
| Compound Name | (4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 133083313 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexene-1-carbaldehyde |
| SMILES | C=C1C(C=O)=CC[C@@H](C)[C@]1(C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O3S/c1-13-9-10-15(11-18)14(2)17(13,3)12-21(19,20)16-7-5-4-6-8-16/h4-8,10-11,13H,2,9,12H2,1,3H3/t13-,17+/m1/s1 |
| InChIKey | CHLZKBOKQFJSBI-DYVFJYSZSA-N |
| XLogP | 3.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|