C24H38O6SSi — CID 11317667
ethyl (3S)-2-[3-(benzenesulfonyl)propanoyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylpent-4-enoate (PubChem CID 11317667) has the molecular formula C24H38O6SSi and a molecular weight of 482.72 g/mol. Its IUPAC name is ethyl (3S)-2-[3-(benzenesulfonyl)propanoyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylpent-4-enoate.
| Compound Name | ethyl (3S)-2-[3-(benzenesulfonyl)propanoyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 11317667 |
| Molecular Formula | C24H38O6SSi |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | ethyl (3S)-2-[3-(benzenesulfonyl)propanoyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylpent-4-enoate |
| SMILES | C=C[C@](C)(CO[Si](C)(C)C(C)(C)C)C(C(=O)CCS(=O)(=O)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C24H38O6SSi/c1-9-24(6,18-30-32(7,8)23(3,4)5)21(22(26)29-10-2)20(25)16-17-31(27,28)19-14-12-11-13-15-19/h9,11-15,21H,1,10,16-18H2,2-8H3/t21?,24-/m1/s1 |
| InChIKey | YZTSBJBCMIBOCF-MQNHUJCZSA-N |
| XLogP | 4.81 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|