C30H40O7S2Si — CID 11114700
cis-methyl (1S,2R)-1-[(E)-5,5-bis(benzenesulfonyl)pent-2-enyl]-2-[tert-butyl(dimethyl)silyl]oxy-2-ethenylcyclopropane-1-carboxylate (PubChem CID 11114700) has the molecular formula C30H40O7S2Si and a molecular weight of 604.86 g/mol. Its IUPAC name is cis-methyl (1S,2R)-1-[(E)-5,5-bis(benzenesulfonyl)pent-2-enyl]-2-[tert-butyl(dimethyl)silyl]oxy-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-1-[(E)-5,5-bis(benzenesulfonyl)pent-2-enyl]-2-[tert-butyl(dimethyl)silyl]oxy-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11114700 |
| Molecular Formula | C30H40O7S2Si |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | cis-methyl (1S,2R)-1-[(E)-5,5-bis(benzenesulfonyl)pent-2-enyl]-2-[tert-butyl(dimethyl)silyl]oxy-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=C[C@]1(O[Si](C)(C)C(C)(C)C)C[C@]1(C/C=C/CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C30H40O7S2Si/c1-8-30(37-40(6,7)28(2,3)4)23-29(30,27(31)36-5)22-16-15-21-26(38(32,33)24-17-11-9-12-18-24)39(34,35)25-19-13-10-14-20-25/h8-20,26H,1,21-23H2,2-7H3/b16-15+/t29-,30+/m1/s1 |
| InChIKey | YSMWOALQHPTBOB-MASLKLJGSA-N |
| XLogP | 6.11 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|