C20H32O5SSi — CID 10431848
methyl (E,2R)-4-(benzenesulfonyl)-2-methyl-2-[(1R)-1-triethylsilyloxyethyl]but-3-enoate (PubChem CID 10431848) has the molecular formula C20H32O5SSi and a molecular weight of 412.62 g/mol. Its IUPAC name is methyl (E,2R)-4-(benzenesulfonyl)-2-methyl-2-[(1R)-1-triethylsilyloxyethyl]but-3-enoate.
| Compound Name | methyl (E,2R)-4-(benzenesulfonyl)-2-methyl-2-[(1R)-1-triethylsilyloxyethyl]but-3-enoate |
|---|---|
| PubChem CID | 10431848 |
| Molecular Formula | C20H32O5SSi |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | methyl (E,2R)-4-(benzenesulfonyl)-2-methyl-2-[(1R)-1-triethylsilyloxyethyl]but-3-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H](C)[C@@](C)(/C=C/S(=O)(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C20H32O5SSi/c1-7-27(8-2,9-3)25-17(4)20(5,19(21)24-6)15-16-26(22,23)18-13-11-10-12-14-18/h10-17H,7-9H2,1-6H3/b16-15+/t17-,20-/m1/s1 |
| InChIKey | FUQORSWAHGNMIZ-KVAHRTBWSA-N |
| XLogP | 4.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|