C28H40O5SSi — CID 10815733
(4R,4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethylspiro[4a,5,6,8-tetrahydrobenzo[8]annulene-4,2'-oxirane]-3-one (PubChem CID 10815733) has the molecular formula C28H40O5SSi and a molecular weight of 516.78 g/mol. Its IUPAC name is (4R,4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethylspiro[4a,5,6,8-tetrahydrobenzo[8]annulene-4,2'-oxirane]-3-one.
| Compound Name | (4R,4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethylspiro[4a,5,6,8-tetrahydrobenzo[8]annulene-4,2'-oxirane]-3-one |
|---|---|
| PubChem CID | 10815733 |
| Molecular Formula | C28H40O5SSi |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (4R,4aR,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethylspiro[4a,5,6,8-tetrahydrobenzo[8]annulene-4,2'-oxirane]-3-one |
| SMILES | CC1(C)C[C@@H](S(=O)(=O)c2ccccc2)[C@@H]2[C@@](C)(C=CC(=O)[C@]23CO3)/C=C\[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H40O5SSi/c1-25(2,3)35(7,8)33-23-15-17-27(6)16-14-22(29)28(19-32-28)24(27)21(18-26(23,4)5)34(30,31)20-12-10-9-11-13-20/h9-17,21,23-24H,18-19H2,1-8H3/b17-15-/t21-,23+,24-,27+,28-/m1/s1 |
| InChIKey | DLKCYGRUZLIQTM-ZVTMJOOZSA-N |
| XLogP | 5.74 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|