C29H44O5SSi — CID 177457943
(4R,4aS,5R,8S,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethyl)-7,7,10a-trimethyl-4a,5,6,8-tetrahydro-4H-benzo[8]annulen-3-one (PubChem CID 177457943) has the molecular formula C29H44O5SSi and a molecular weight of 532.82 g/mol. Its IUPAC name is (4R,4aS,5R,8S,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethyl)-7,7,10a-trimethyl-4a,5,6,8-tetrahydro-4H-benzo[8]annulen-3-one.
| Compound Name | (4R,4aS,5R,8S,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethyl)-7,7,10a-trimethyl-4a,5,6,8-tetrahydro-4H-benzo[8]annulen-3-one |
|---|---|
| PubChem CID | 177457943 |
| Molecular Formula | C29H44O5SSi |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | (4R,4aS,5R,8S,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethyl)-7,7,10a-trimethyl-4a,5,6,8-tetrahydro-4H-benzo[8]annulen-3-one |
| SMILES | COC[C@@H]1C(=O)C=C[C@@]2(C)C=C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C[C@@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C29H44O5SSi/c1-27(2,3)36(8,9)34-25-16-18-29(6)17-15-23(30)22(20-33-7)26(29)24(19-28(25,4)5)35(31,32)21-13-11-10-12-14-21/h10-18,22,24-26H,19-20H2,1-9H3/t22-,24-,25+,26-,29+/m1/s1 |
| InChIKey | MOVWXYLWWMSLDO-VMQCTCBBSA-N |
| XLogP | 6.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|