C27H40O4SSi — CID 177463818
(4aR,5S,8R,10aS)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydro-4H-benzo[8]annulen-3-one (PubChem CID 177463818) has the molecular formula C27H40O4SSi and a molecular weight of 488.77 g/mol. Its IUPAC name is (4aR,5S,8R,10aS)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydro-4H-benzo[8]annulen-3-one.
| Compound Name | (4aR,5S,8R,10aS)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydro-4H-benzo[8]annulen-3-one |
|---|---|
| PubChem CID | 177463818 |
| Molecular Formula | C27H40O4SSi |
| Molecular Weight | 488.77 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (4aR,5S,8R,10aS)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydro-4H-benzo[8]annulen-3-one |
| SMILES | CC1(C)C[C@H](S(=O)(=O)c2ccccc2)[C@@H]2CC(=O)C=C[C@]2(C)C=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H40O4SSi/c1-25(2,3)33(7,8)31-24-15-17-27(6)16-14-20(28)18-22(27)23(19-26(24,4)5)32(29,30)21-12-10-9-11-13-21/h9-17,22-24H,18-19H2,1-8H3/t22-,23-,24+,27+/m0/s1 |
| InChIKey | XDFHGIVYRYRXPV-QRXMYIDTSA-N |
| XLogP | 6.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.77 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|