C29H42O6SSi — CID 11800734
methyl (4S,4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3-oxo-4a,5,6,8-tetrahydro-4H-benzo[8]annulene-4-carboxylate (PubChem CID 11800734) has the molecular formula C29H42O6SSi and a molecular weight of 546.80 g/mol. Its IUPAC name is methyl (4S,4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3-oxo-4a,5,6,8-tetrahydro-4H-benzo[8]annulene-4-carboxylate.
| Compound Name | methyl (4S,4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3-oxo-4a,5,6,8-tetrahydro-4H-benzo[8]annulene-4-carboxylate |
|---|---|
| PubChem CID | 11800734 |
| Molecular Formula | C29H42O6SSi |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | methyl (4S,4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3-oxo-4a,5,6,8-tetrahydro-4H-benzo[8]annulene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C=C[C@@]2(C)/C=C\[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C[C@@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C29H42O6SSi/c1-27(2,3)37(8,9)35-23-16-18-29(6)17-15-21(30)24(26(31)34-7)25(29)22(19-28(23,4)5)36(32,33)20-13-11-10-12-14-20/h10-18,22-25H,19H2,1-9H3/b18-16-/t22-,23+,24-,25+,29+/m1/s1 |
| InChIKey | IUJLCTMZJARWFX-YTAVMKMHSA-N |
| XLogP | 5.76 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|