C26H38O4SSi — CID 10254334
6-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyl-1-phenylheptan-3-one (PubChem CID 10254334) has the molecular formula C26H38O4SSi and a molecular weight of 474.74 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyl-1-phenylheptan-3-one.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyl-1-phenylheptan-3-one |
|---|---|
| PubChem CID | 10254334 |
| Molecular Formula | C26H38O4SSi |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyl-1-phenylheptan-3-one |
| SMILES | Cc1ccc(S(=O)(=O)C(CC(C)O[Si](C)(C)C(C)(C)C)C(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H38O4SSi/c1-20-13-16-23(17-14-20)31(28,29)25(19-21(2)30-32(6,7)26(3,4)5)24(27)18-15-22-11-9-8-10-12-22/h8-14,16-17,21,25H,15,18-19H2,1-7H3 |
| InChIKey | ODLJWVWIFJNMHE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|