C25H33F3O2SSi — CID 10323000
(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-7-phenyl-4-phenylsulfanylheptan-2-one (PubChem CID 10323000) has the molecular formula C25H33F3O2SSi and a molecular weight of 482.68 g/mol. Its IUPAC name is (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-7-phenyl-4-phenylsulfanylheptan-2-one.
| Compound Name | (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-7-phenyl-4-phenylsulfanylheptan-2-one |
|---|---|
| PubChem CID | 10323000 |
| Molecular Formula | C25H33F3O2SSi |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-7-phenyl-4-phenylsulfanylheptan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCc1ccccc1)[C@@H](CC(=O)C(F)(F)F)Sc1ccccc1 |
| InChI | InChI=1S/C25H33F3O2SSi/c1-24(2,3)32(4,5)30-21(17-16-19-12-8-6-9-13-19)22(18-23(29)25(26,27)28)31-20-14-10-7-11-15-20/h6-15,21-22H,16-18H2,1-5H3/t21-,22-/m1/s1 |
| InChIKey | MNFKDQNITXAXOG-FGZHOGPDSA-N |
| XLogP | 7.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|