C36H50O7SSi — CID 10461971
(8S,9S)-6-(benzenesulfonyl)-10-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-9-(methoxymethoxy)-4,8-dimethyldecan-5-one (PubChem CID 10461971) has the molecular formula C36H50O7SSi and a molecular weight of 654.94 g/mol. Its IUPAC name is (8S,9S)-6-(benzenesulfonyl)-10-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-9-(methoxymethoxy)-4,8-dimethyldecan-5-one.
| Compound Name | (8S,9S)-6-(benzenesulfonyl)-10-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-9-(methoxymethoxy)-4,8-dimethyldecan-5-one |
|---|---|
| PubChem CID | 10461971 |
| Molecular Formula | C36H50O7SSi |
| Molecular Weight | 654.94 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | (8S,9S)-6-(benzenesulfonyl)-10-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-9-(methoxymethoxy)-4,8-dimethyldecan-5-one |
| SMILES | COCO[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CC(C(=O)C(C)CCCO)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H50O7SSi/c1-28(17-16-24-37)35(38)34(44(39,40)30-18-10-7-11-19-30)25-29(2)33(42-27-41-6)26-43-45(36(3,4)5,31-20-12-8-13-21-31)32-22-14-9-15-23-32/h7-15,18-23,28-29,33-34,37H,16-17,24-27H2,1-6H3/t28?,29-,33+,34?/m0/s1 |
| InChIKey | QTSBJGNCJGJQGI-APUBPUAOSA-N |
| XLogP | 5.40 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.94 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|