C39H54O6SSi — CID 10508729
(5E,7S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-7-hydroxy-9-(2-methoxyethoxymethoxy)-2,2-dimethyl-1-phenylsulfanylnonan-3-one (PubChem CID 10508729) has the molecular formula C39H54O6SSi and a molecular weight of 679.01 g/mol. Its IUPAC name is (5E,7S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-7-hydroxy-9-(2-methoxyethoxymethoxy)-2,2-dimethyl-1-phenylsulfanylnonan-3-one.
| Compound Name | (5E,7S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-7-hydroxy-9-(2-methoxyethoxymethoxy)-2,2-dimethyl-1-phenylsulfanylnonan-3-one |
|---|---|
| PubChem CID | 10508729 |
| Molecular Formula | C39H54O6SSi |
| Molecular Weight | 679.01 g/mol |
| Exact Mass | 678.34 |
| IUPAC Name | (5E,7S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-7-hydroxy-9-(2-methoxyethoxymethoxy)-2,2-dimethyl-1-phenylsulfanylnonan-3-one |
| SMILES | COCCOCOCC[C@@H](O)C/C(=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(=O)C(C)(C)CSc1ccccc1 |
| InChI | InChI=1S/C39H54O6SSi/c1-38(2,3)47(35-18-12-8-13-19-35,36-20-14-9-15-21-36)45-25-22-32(28-33(40)23-24-43-31-44-27-26-42-6)29-37(41)39(4,5)30-46-34-16-10-7-11-17-34/h7-22,33,40H,23-31H2,1-6H3/b32-22+/t33-/m1/s1 |
| InChIKey | IDEYHXQGVFDKBA-BBIZNSKESA-N |
| XLogP | 7.05 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.01 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|