C33H42O3SSi — CID 10530635
(E)-7-[tert-butyl(diphenyl)silyl]oxy-5-(2-hydroxyethyl)-2,2-dimethyl-1-phenylsulfanylhept-5-en-3-one (PubChem CID 10530635) has the molecular formula C33H42O3SSi and a molecular weight of 546.85 g/mol. Its IUPAC name is (E)-7-[tert-butyl(diphenyl)silyl]oxy-5-(2-hydroxyethyl)-2,2-dimethyl-1-phenylsulfanylhept-5-en-3-one.
| Compound Name | (E)-7-[tert-butyl(diphenyl)silyl]oxy-5-(2-hydroxyethyl)-2,2-dimethyl-1-phenylsulfanylhept-5-en-3-one |
|---|---|
| PubChem CID | 10530635 |
| Molecular Formula | C33H42O3SSi |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (E)-7-[tert-butyl(diphenyl)silyl]oxy-5-(2-hydroxyethyl)-2,2-dimethyl-1-phenylsulfanylhept-5-en-3-one |
| SMILES | CC(C)(CSc1ccccc1)C(=O)C/C(=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCO |
| InChI | InChI=1S/C33H42O3SSi/c1-32(2,3)38(29-17-11-7-12-18-29,30-19-13-8-14-20-30)36-24-22-27(21-23-34)25-31(35)33(4,5)26-37-28-15-9-6-10-16-28/h6-20,22,34H,21,23-26H2,1-5H3/b27-22+ |
| InChIKey | YNDSTKHSGJZBGA-HPNDGRJYSA-N |
| XLogP | 6.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|