C40H54O5SSi — CID 177384277
(5E,7S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-7-hydroxy-2,2-dimethyl-1-phenylsulfanyl-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octan-3-one (PubChem CID 177384277) has the molecular formula C40H54O5SSi and a molecular weight of 675.02 g/mol. Its IUPAC name is (5E,7S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-7-hydroxy-2,2-dimethyl-1-phenylsulfanyl-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octan-3-one.
| Compound Name | (5E,7S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-7-hydroxy-2,2-dimethyl-1-phenylsulfanyl-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octan-3-one |
|---|---|
| PubChem CID | 177384277 |
| Molecular Formula | C40H54O5SSi |
| Molecular Weight | 675.02 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | (5E,7S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-7-hydroxy-2,2-dimethyl-1-phenylsulfanyl-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octan-3-one |
| SMILES | C[C@H]1OC(C)(C)O[C@@H]1C[C@@H](O)C/C(=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(=O)C(C)(C)CSc1ccccc1 |
| InChI | InChI=1S/C40H54O5SSi/c1-30-36(45-40(7,8)44-30)28-32(41)26-31(27-37(42)39(5,6)29-46-33-18-12-9-13-19-33)24-25-43-47(38(2,3)4,34-20-14-10-15-21-34)35-22-16-11-17-23-35/h9-24,30,32,36,41H,25-29H2,1-8H3/b31-24+/t30-,32+,36-/m1/s1 |
| InChIKey | FUYZGWKFHFTHAV-GSEGNHDQSA-N |
| XLogP | 7.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.02 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|