C35H52O5S2Si — CID 11966686
(4R)-1-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-4-hydroxy-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-one (PubChem CID 11966686) has the molecular formula C35H52O5S2Si and a molecular weight of 645.02 g/mol. Its IUPAC name is (4R)-1-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-4-hydroxy-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-one.
| Compound Name | (4R)-1-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-4-hydroxy-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-one |
|---|---|
| PubChem CID | 11966686 |
| Molecular Formula | C35H52O5S2Si |
| Molecular Weight | 645.02 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | (4R)-1-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-4-hydroxy-5-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-one |
| SMILES | C[C@H]1OC(C)(C)O[C@@H]1C[C@@H](O)CC(=O)CC1(C(C)(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C35H52O5S2Si/c1-26-31(40-34(7,8)39-26)23-27(36)22-28(37)24-35(41-20-15-21-42-35)33(5,6)25-38-43(32(2,3)4,29-16-11-9-12-17-29)30-18-13-10-14-19-30/h9-14,16-19,26-27,31,36H,15,20-25H2,1-8H3/t26-,27+,31-/m1/s1 |
| InChIKey | OHHCTMODIROFMY-FMVCKAMOSA-N |
| XLogP | 6.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.02 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|