C36H52O7S2Si — CID 102378657
(5S)-6-[(2S,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxyoxolan-2-yl]-1-[2-[(3S)-3,4-dihydroxybutyl]-1,3-dithian-2-yl]-5-methylhexane-1,4-dione (PubChem CID 102378657) has the molecular formula C36H52O7S2Si and a molecular weight of 689.03 g/mol. Its IUPAC name is (5S)-6-[(2S,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxyoxolan-2-yl]-1-[2-[(3S)-3,4-dihydroxybutyl]-1,3-dithian-2-yl]-5-methylhexane-1,4-dione.
| Compound Name | (5S)-6-[(2S,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxyoxolan-2-yl]-1-[2-[(3S)-3,4-dihydroxybutyl]-1,3-dithian-2-yl]-5-methylhexane-1,4-dione |
|---|---|
| PubChem CID | 102378657 |
| Molecular Formula | C36H52O7S2Si |
| Molecular Weight | 689.03 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | (5S)-6-[(2S,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxyoxolan-2-yl]-1-[2-[(3S)-3,4-dihydroxybutyl]-1,3-dithian-2-yl]-5-methylhexane-1,4-dione |
| SMILES | C[C@@H](C[C@@H]1O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1O)C(=O)CCC(=O)C1(CC[C@H](O)CO)SCCCS1 |
| InChI | InChI=1S/C36H52O7S2Si/c1-26(31(39)16-17-34(41)36(19-18-27(38)24-37)44-20-11-21-45-36)22-33-32(40)23-28(43-33)25-42-46(35(2,3)4,29-12-7-5-8-13-29)30-14-9-6-10-15-30/h5-10,12-15,26-28,32-33,37-38,40H,11,16-25H2,1-4H3/t26-,27-,28+,32-,33-/m0/s1 |
| InChIKey | KXGPGGFCLGPBLS-RNHCGKMISA-N |
| XLogP | 4.73 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.03 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|